C10H13NO4 — CID 134858457
(5S)-2-ethyl-5-hydroperoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 134858457) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (5S)-2-ethyl-5-hydroperoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (5S)-2-ethyl-5-hydroperoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134858457 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5S)-2-ethyl-5-hydroperoxy-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCN1C(=O)C2C=C[C@@H](OO)CC2C1=O |
| InChI | InChI=1S/C10H13NO4/c1-2-11-9(12)7-4-3-6(15-14)5-8(7)10(11)13/h3-4,6-8,14H,2,5H2,1H3/t6-,7?,8?/m1/s1 |
| InChIKey | WUDDKGPLLWQIER-JECWYVHBSA-N |
| XLogP | 0.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|