C18H28F2N4O2 — CID 111288597
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111288597) has the molecular formula C18H28F2N4O2 and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111288597 |
| Molecular Formula | C18H28F2N4O2 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCN1CCOCC1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H28F2N4O2/c1-3-21-18(22-8-9-24-10-12-25-13-11-24)23(2)14-15-4-6-16(7-5-15)26-17(19)20/h4-7,17H,3,8-14H2,1-2H3,(H,21,22) |
| InChIKey | ZVPBQJPYSWUUGE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|