C17H27ClN4 — CID 111293709
1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(1-methylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111293709) has the molecular formula C17H27ClN4 and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(1-methylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111293709 |
| Molecular Formula | C17H27ClN4 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCCN1C)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClN4/c1-4-19-17(20-12-16-6-5-11-21(16)2)22(3)13-14-7-9-15(18)10-8-14/h7-10,16H,4-6,11-13H2,1-3H3,(H,19,20) |
| InChIKey | DNFIKLGULYJJSM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|