C14H27NO4 — CID 11129475
(E,4S)-9-hydroxy-4,8-bis(hydroxymethyl)-N,N,4-trimethylnon-5-enamide (PubChem CID 11129475) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is (E,4S)-9-hydroxy-4,8-bis(hydroxymethyl)-N,N,4-trimethylnon-5-enamide.
| Compound Name | (E,4S)-9-hydroxy-4,8-bis(hydroxymethyl)-N,N,4-trimethylnon-5-enamide |
|---|---|
| PubChem CID | 11129475 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (E,4S)-9-hydroxy-4,8-bis(hydroxymethyl)-N,N,4-trimethylnon-5-enamide |
| SMILES | CN(C)C(=O)CC[C@@](C)(/C=C/CC(CO)CO)CO |
| InChI | InChI=1S/C14H27NO4/c1-14(11-18,8-6-13(19)15(2)3)7-4-5-12(9-16)10-17/h4,7,12,16-18H,5-6,8-11H2,1-3H3/b7-4+/t14-/m1/s1 |
| InChIKey | LPHXWQKYQAPEKS-BTKRWWFXSA-N |
| XLogP | 0.40 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|