C9H17NO2 — CID 56957285
3-(2-hydroxyethyl)-N,N-dimethylpent-4-enamide (PubChem CID 56957285) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-N,N-dimethylpent-4-enamide.
| Compound Name | 3-(2-hydroxyethyl)-N,N-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 56957285 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-(2-hydroxyethyl)-N,N-dimethylpent-4-enamide |
| SMILES | C=CC(CCO)CC(=O)N(C)C |
| InChI | InChI=1S/C9H17NO2/c1-4-8(5-6-11)7-9(12)10(2)3/h4,8,11H,1,5-7H2,2-3H3 |
| InChIKey | CULGKAGXJPRQTF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|