C11H21NO2 — CID 11412975
(3R,5S)-5-hydroxy-N,N,3-trimethyloct-7-enamide (PubChem CID 11412975) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3R,5S)-5-hydroxy-N,N,3-trimethyloct-7-enamide.
| Compound Name | (3R,5S)-5-hydroxy-N,N,3-trimethyloct-7-enamide |
|---|---|
| PubChem CID | 11412975 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3R,5S)-5-hydroxy-N,N,3-trimethyloct-7-enamide |
| SMILES | C=CC[C@H](O)C[C@@H](C)CC(=O)N(C)C |
| InChI | InChI=1S/C11H21NO2/c1-5-6-10(13)7-9(2)8-11(14)12(3)4/h5,9-10,13H,1,6-8H2,2-4H3/t9-,10+/m1/s1 |
| InChIKey | VXQYOIPFIVZQTD-ZJUUUORDSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|