C12H23NO3 — CID 11817060
(2R,3R,4R)-3-(2-hydroxyethyl)-N-methoxy-N,2,4-trimethylhex-5-enamide (PubChem CID 11817060) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is (2R,3R,4R)-3-(2-hydroxyethyl)-N-methoxy-N,2,4-trimethylhex-5-enamide.
| Compound Name | (2R,3R,4R)-3-(2-hydroxyethyl)-N-methoxy-N,2,4-trimethylhex-5-enamide |
|---|---|
| PubChem CID | 11817060 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (2R,3R,4R)-3-(2-hydroxyethyl)-N-methoxy-N,2,4-trimethylhex-5-enamide |
| SMILES | C=C[C@@H](C)[C@@H](CCO)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C12H23NO3/c1-6-9(2)11(7-8-14)10(3)12(15)13(4)16-5/h6,9-11,14H,1,7-8H2,2-5H3/t9-,10-,11-/m1/s1 |
| InChIKey | MVXNONWDOCAHNR-GMTAPVOTSA-N |
| XLogP | 1.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|