C9H17NO2 — CID 141002372
(2S)-2-(3-hydroxypropyl)-N-methylpent-4-enamide (PubChem CID 141002372) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (2S)-2-(3-hydroxypropyl)-N-methylpent-4-enamide.
| Compound Name | (2S)-2-(3-hydroxypropyl)-N-methylpent-4-enamide |
|---|---|
| PubChem CID | 141002372 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2S)-2-(3-hydroxypropyl)-N-methylpent-4-enamide |
| SMILES | C=CCC(CCCO)C(=O)NC |
| InChI | InChI=1S/C9H17NO2/c1-3-5-8(6-4-7-11)9(12)10-2/h3,8,11H,1,4-7H2,2H3,(H,10,12) |
| InChIKey | NTIQWKKDIUQIHU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|