C11H21NO2 — CID 103861440
N-(5-hydroxy-4-methylpentyl)pent-4-enamide (PubChem CID 103861440) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(5-hydroxy-4-methylpentyl)pent-4-enamide.
| Compound Name | N-(5-hydroxy-4-methylpentyl)pent-4-enamide |
|---|---|
| PubChem CID | 103861440 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(5-hydroxy-4-methylpentyl)pent-4-enamide |
| SMILES | C=CCCC(=O)NCCCC(C)CO |
| InChI | InChI=1S/C11H21NO2/c1-3-4-7-11(14)12-8-5-6-10(2)9-13/h3,10,13H,1,4-9H2,2H3,(H,12,14) |
| InChIKey | MEGJETJASLAKAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|