C11H21NO3 — CID 123574183
N-(3-ethenyl-5,6-dihydroxyhexyl)propanamide (PubChem CID 123574183) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-(3-ethenyl-5,6-dihydroxyhexyl)propanamide.
| Compound Name | N-(3-ethenyl-5,6-dihydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 123574183 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-(3-ethenyl-5,6-dihydroxyhexyl)propanamide |
| SMILES | C=CC(CCNC(=O)CC)CC(O)CO |
| InChI | InChI=1S/C11H21NO3/c1-3-9(7-10(14)8-13)5-6-12-11(15)4-2/h3,9-10,13-14H,1,4-8H2,2H3,(H,12,15) |
| InChIKey | LLWBGTJXGCJSSI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|