C11H21NO5 — CID 123724343
N-(3-ethenyl-2,4,5,6-tetrahydroxyhexyl)propanamide (PubChem CID 123724343) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-(3-ethenyl-2,4,5,6-tetrahydroxyhexyl)propanamide.
| Compound Name | N-(3-ethenyl-2,4,5,6-tetrahydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 123724343 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(3-ethenyl-2,4,5,6-tetrahydroxyhexyl)propanamide |
| SMILES | C=CC(C(O)CNC(=O)CC)C(O)C(O)CO |
| InChI | InChI=1S/C11H21NO5/c1-3-7(11(17)9(15)6-13)8(14)5-12-10(16)4-2/h3,7-9,11,13-15,17H,1,4-6H2,2H3,(H,12,16) |
| InChIKey | JTYYOVCVTVOAOH-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|