C12H21NO3 — CID 163606988
N-[(3R,5S)-3-ethenyl-5,6-dihydroxyhexyl]but-3-enamide (PubChem CID 163606988) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[(3R,5S)-3-ethenyl-5,6-dihydroxyhexyl]but-3-enamide.
| Compound Name | N-[(3R,5S)-3-ethenyl-5,6-dihydroxyhexyl]but-3-enamide |
|---|---|
| PubChem CID | 163606988 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[(3R,5S)-3-ethenyl-5,6-dihydroxyhexyl]but-3-enamide |
| SMILES | C=CCC(=O)NCC[C@@H](C=C)C[C@H](O)CO |
| InChI | InChI=1S/C12H21NO3/c1-3-5-12(16)13-7-6-10(4-2)8-11(15)9-14/h3-4,10-11,14-15H,1-2,5-9H2,(H,13,16)/t10-,11+/m1/s1 |
| InChIKey | HCQDJIWTKQLJIE-MNOVXSKESA-N |
| XLogP | 0.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|