C12H21NO2 — CID 107202259
N-(5-hydroxypentyl)-N-methylcyclopent-3-ene-1-carboxamide (PubChem CID 107202259) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N-methylcyclopent-3-ene-1-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-N-methylcyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 107202259 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(5-hydroxypentyl)-N-methylcyclopent-3-ene-1-carboxamide |
| SMILES | CN(CCCCCO)C(=O)C1CC=CC1 |
| InChI | InChI=1S/C12H21NO2/c1-13(9-5-2-6-10-14)12(15)11-7-3-4-8-11/h3-4,11,14H,2,5-10H2,1H3 |
| InChIKey | PXSHHHDWLDQJKF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|