C17H31NO2 — CID 57062128
1-[2-(hydroxymethyl)pyrrolidin-1-yl]-7-methyl-2-propan-2-yloct-4-en-1-one (PubChem CID 57062128) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-7-methyl-2-propan-2-yloct-4-en-1-one.
| Compound Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-7-methyl-2-propan-2-yloct-4-en-1-one |
|---|---|
| PubChem CID | 57062128 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-7-methyl-2-propan-2-yloct-4-en-1-one |
| SMILES | CC(C)CC=CCC(C(=O)N1CCCC1CO)C(C)C |
| InChI | InChI=1S/C17H31NO2/c1-13(2)8-5-6-10-16(14(3)4)17(20)18-11-7-9-15(18)12-19/h5-6,13-16,19H,7-12H2,1-4H3 |
| InChIKey | NNUACNDSJDUCIK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|