C13H19NO2 — CID 135042881
[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(1-methylcyclohexa-2,5-dien-1-yl)methanone (PubChem CID 135042881) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(1-methylcyclohexa-2,5-dien-1-yl)methanone.
| Compound Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(1-methylcyclohexa-2,5-dien-1-yl)methanone |
|---|---|
| PubChem CID | 135042881 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(1-methylcyclohexa-2,5-dien-1-yl)methanone |
| SMILES | CC1(C(=O)N2CCC[C@@H]2CO)C=CCC=C1 |
| InChI | InChI=1S/C13H19NO2/c1-13(7-3-2-4-8-13)12(16)14-9-5-6-11(14)10-15/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | MUVUBAJRPQXBIT-LLVKDONJSA-N |
| XLogP | 1.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|