C12H21NO2 — CID 143689645
3,6-diethyl-2-hydroxy-1,4-dimethyl-3,6-dihydro-2H-azepin-7-one (PubChem CID 143689645) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3,6-diethyl-2-hydroxy-1,4-dimethyl-3,6-dihydro-2H-azepin-7-one.
| Compound Name | 3,6-diethyl-2-hydroxy-1,4-dimethyl-3,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 143689645 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3,6-diethyl-2-hydroxy-1,4-dimethyl-3,6-dihydro-2H-azepin-7-one |
| SMILES | CCC1C=C(C)C(CC)C(O)N(C)C1=O |
| InChI | InChI=1S/C12H21NO2/c1-5-9-7-8(3)10(6-2)12(15)13(4)11(9)14/h7,9-10,12,15H,5-6H2,1-4H3 |
| InChIKey | FGEMXXOXTBWFAV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|