C12H23NO2 — CID 143932155
(E)-8-hydroxy-N,N,7-trimethylnon-4-enamide (PubChem CID 143932155) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-8-hydroxy-N,N,7-trimethylnon-4-enamide.
| Compound Name | (E)-8-hydroxy-N,N,7-trimethylnon-4-enamide |
|---|---|
| PubChem CID | 143932155 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (E)-8-hydroxy-N,N,7-trimethylnon-4-enamide |
| SMILES | CC(O)C(C)C/C=C/CCC(=O)N(C)C |
| InChI | InChI=1S/C12H23NO2/c1-10(11(2)14)8-6-5-7-9-12(15)13(3)4/h5-6,10-11,14H,7-9H2,1-4H3/b6-5+ |
| InChIKey | JMCBJMVVZAXBGN-AATRIKPKSA-N |
| XLogP | 1.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|