C22H28ClIN4O2 — CID 111294838
N-[3-[[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111294838) has the molecular formula C22H28ClIN4O2 and a molecular weight of 542.85 g/mol. Its IUPAC name is N-[3-[[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111294838 |
| Molecular Formula | C22H28ClIN4O2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | N-[3-[[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCO2)c1)N(C)Cc1ccccc1Cl.I |
| InChI | InChI=1S/C22H27ClN4O2.HI/c1-24-22(27(2)15-17-8-3-4-10-19(17)23)25-14-16-7-5-9-18(13-16)26-21(28)20-11-6-12-29-20;/h3-5,7-10,13,20H,6,11-12,14-15H2,1-2H3,(H,24,25)(H,26,28);1H |
| InChIKey | KAVQXKOCJANMTJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|