C19H25ClN4O2S — CID 111295019
3-[2-(benzylsulfamoyl)ethyl]-1-[(2-chlorophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111295019) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 3-[2-(benzylsulfamoyl)ethyl]-1-[(2-chlorophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(benzylsulfamoyl)ethyl]-1-[(2-chlorophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111295019 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[2-(benzylsulfamoyl)ethyl]-1-[(2-chlorophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)NCc1ccccc1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H25ClN4O2S/c1-21-19(24(2)15-17-10-6-7-11-18(17)20)22-12-13-27(25,26)23-14-16-8-4-3-5-9-16/h3-11,23H,12-15H2,1-2H3,(H,21,22) |
| InChIKey | PKQWZLDLUWEBOH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|