C21H33F3IN5O — CID 111295258
N,N-dimethyl-1-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111295258) has the molecular formula C21H33F3IN5O and a molecular weight of 555.43 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111295258 |
| Molecular Formula | C21H33F3IN5O |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCCC1C(=O)N(C)C)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C21H32F3N5O.HI/c1-25-20(27-13-11-16-7-9-17(10-8-16)21(22,23)24)26-12-5-15-29-14-4-6-18(29)19(30)28(2)3;/h7-10,18H,4-6,11-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | BXTILSGUKMOBPX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|