C20H32ClN5O — CID 111358156
1-[3-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111358156) has the molecular formula C20H32ClN5O and a molecular weight of 393.96 g/mol. Its IUPAC name is 1-[3-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111358156 |
| Molecular Formula | C20H32ClN5O |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[3-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC1C(=O)N(C)C)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H32ClN5O/c1-22-20(24-12-10-16-7-4-8-17(21)15-16)23-11-6-14-26-13-5-9-18(26)19(27)25(2)3/h4,7-8,15,18H,5-6,9-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | RDJVGQOIAJQXLG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|