C22H37N5O4 — CID 111377086
N,N-dimethyl-1-[3-[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 111377086) has the molecular formula C22H37N5O4 and a molecular weight of 435.57 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111377086 |
| Molecular Formula | C22H37N5O4 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC1C(=O)N(C)C)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H37N5O4/c1-23-22(24-10-8-12-27-11-7-9-17(27)21(28)26(2)3)25-15-16-13-18(29-4)20(31-6)19(14-16)30-5/h13-14,17H,7-12,15H2,1-6H3,(H2,23,24,25) |
| InChIKey | CJJHEROZSVVZGM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|