C21H35N5O3 — CID 111878197
1-[3-[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111878197) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[3-[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111878197 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-[3-[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC1C(=O)N(C)C)NCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C21H35N5O3/c1-22-21(24-15-16-9-10-17(28-4)14-19(16)29-5)23-11-7-13-26-12-6-8-18(26)20(27)25(2)3/h9-10,14,18H,6-8,11-13,15H2,1-5H3,(H2,22,23,24) |
| InChIKey | XLVVGTAXTVKQDG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|