C20H33F3N4 — CID 111295313
1-ethyl-2-[4-[methyl(propan-2-yl)amino]butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111295313) has the molecular formula C20H33F3N4 and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-ethyl-2-[4-[methyl(propan-2-yl)amino]butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[4-[methyl(propan-2-yl)amino]butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111295313 |
| Molecular Formula | C20H33F3N4 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-ethyl-2-[4-[methyl(propan-2-yl)amino]butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCCN(C)C(C)C)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H33F3N4/c1-5-24-19(25-13-6-7-15-27(4)16(2)3)26-14-12-17-8-10-18(11-9-17)20(21,22)23/h8-11,16H,5-7,12-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | VZDVGBOBOZYKFT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|