C21H35F3IN5 — CID 111295468
1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295468) has the molecular formula C21H35F3IN5 and a molecular weight of 541.44 g/mol. Its IUPAC name is 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295468 |
| Molecular Formula | C21H35F3IN5 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 1-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(C)CC1)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C21H34F3N5.HI/c1-3-25-20(26-11-4-5-13-29-16-14-28(2)15-17-29)27-12-10-18-6-8-19(9-7-18)21(22,23)24;/h6-9H,3-5,10-17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | XBOXGDOPHQQMLR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|