C20H32F3IN4 — CID 111295764
1-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295764) has the molecular formula C20H32F3IN4 and a molecular weight of 512.40 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295764 |
| Molecular Formula | C20H32F3IN4 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN(CC)C1)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H31F3N4.HI/c1-3-24-19(26-14-17-6-5-13-27(4-2)15-17)25-12-11-16-7-9-18(10-8-16)20(21,22)23;/h7-10,17H,3-6,11-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | UVQSZGZDXWKEFL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|