C11H10N4OS2 — CID 11129626
(3R,4S)-6-amino-5-cyano-2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxamide (PubChem CID 11129626) has the molecular formula C11H10N4OS2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (3R,4S)-6-amino-5-cyano-2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxamide.
| Compound Name | (3R,4S)-6-amino-5-cyano-2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11129626 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (3R,4S)-6-amino-5-cyano-2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-pyridine-3-carboxamide |
| SMILES | N#CC1=C(N)NC(=S)[C@@H](C(N)=O)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C11H10N4OS2/c12-4-5-7(6-2-1-3-18-6)8(10(14)16)11(17)15-9(5)13/h1-3,7-8H,13H2,(H2,14,16)(H,15,17)/t7-,8+/m0/s1 |
| InChIKey | OQOVKSACILJPGE-JGVFFNPUSA-N |
| XLogP | 0.56 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|