C25H33N5O2 — CID 111296863
2-[2-(1-benzylimidazol-2-yl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methylguanidine (PubChem CID 111296863) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[2-(1-benzylimidazol-2-yl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methylguanidine.
| Compound Name | 2-[2-(1-benzylimidazol-2-yl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111296863 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 2-[2-(1-benzylimidazol-2-yl)ethyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CCc1nccn1Cc1ccccc1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C25H33N5O2/c1-5-26-25(29(2)19-21-11-12-22(31-3)17-23(21)32-4)28-14-13-24-27-15-16-30(24)18-20-9-7-6-8-10-20/h6-12,15-17H,5,13-14,18-19H2,1-4H3,(H,26,28) |
| InChIKey | UELUKVFUCQPMQP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|