C22H35F3N4O2 — CID 111297595
1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111297595) has the molecular formula C22H35F3N4O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111297595 |
| Molecular Formula | C22H35F3N4O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)NC(C)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C22H35F3N4O2/c1-5-26-21(27-13-17-10-11-29(14-17)15-22(23,24)25)28-16(4)18-8-9-19(30-6-2)20(12-18)31-7-3/h8-9,12,16-17H,5-7,10-11,13-15H2,1-4H3,(H2,26,27,28) |
| InChIKey | DFMHOHDUUUMVFD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|