C25H34N6 — CID 111298505
2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine (PubChem CID 111298505) has the molecular formula C25H34N6 and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine.
| Compound Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111298505 |
| Molecular Formula | C25H34N6 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccc2)NC(C)c2ccc(CC(C)C)cc2)n1C |
| InChI | InChI=1S/C25H34N6/c1-18(2)15-21-11-13-23(14-12-21)19(3)28-25(26-16-22-9-7-6-8-10-22)27-17-24-30-29-20(4)31(24)5/h6-14,18-19H,15-17H2,1-5H3,(H2,26,27,28) |
| InChIKey | LTQBIQFHUKIHEK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|