C11H12F2N2O5 — CID 11130019
methyl 2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-difluorooxolan-2-yl]acetate (PubChem CID 11130019) has the molecular formula C11H12F2N2O5 and a molecular weight of 290.22 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-difluorooxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-difluorooxolan-2-yl]acetate |
|---|---|
| PubChem CID | 11130019 |
| Molecular Formula | C11H12F2N2O5 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-difluorooxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](F)[C@@H]1F |
| InChI | InChI=1S/C11H12F2N2O5/c1-19-7(17)4-5-8(12)9(13)10(20-5)15-3-2-6(16)14-11(15)18/h2-3,5,8-10H,4H2,1H3,(H,14,16,18)/t5-,8-,9-,10-/m1/s1 |
| InChIKey | MFKGWVGQUPWNEZ-UUOKUNOPSA-N |
| XLogP | -0.33 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |