C19H31N5O2S — CID 111300397
N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111300397) has the molecular formula C19H31N5O2S and a molecular weight of 393.56 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111300397 |
| Molecular Formula | C19H31N5O2S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1csc(C(C)C)n1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H31N5O2S/c1-14(2)17-22-15(13-27-17)6-7-21-19(20-3)24-10-8-23(9-11-24)18(25)16-5-4-12-26-16/h13-14,16H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | QAFYSKAYPMPNOU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|