C18H25Cl2IN4O2 — CID 111300426
N-[(2,4-dichlorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111300426) has the molecular formula C18H25Cl2IN4O2 and a molecular weight of 527.23 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111300426 |
| Molecular Formula | C18H25Cl2IN4O2 |
| Molecular Weight | 527.23 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1Cl)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C18H24Cl2N4O2.HI/c1-21-18(22-12-13-4-5-14(19)11-15(13)20)24-8-6-23(7-9-24)17(25)16-3-2-10-26-16;/h4-5,11,16H,2-3,6-10,12H2,1H3,(H,21,22);1H |
| InChIKey | HFOFRLSCQLZUPY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|