C22H35IN4O3S — CID 111300980
N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111300980) has the molecular formula C22H35IN4O3S and a molecular weight of 562.52 g/mol. Its IUPAC name is N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111300980 |
| Molecular Formula | C22H35IN4O3S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)CSc1ccccc1OC)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C22H34N4O3S.HI/c1-17(16-30-20-9-5-4-7-18(20)28-3)15-24-22(23-2)26-12-10-25(11-13-26)21(27)19-8-6-14-29-19;/h4-5,7,9,17,19H,6,8,10-16H2,1-3H3,(H,23,24);1H |
| InChIKey | ZOSGSHJDZPTGNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|