C20H32N6O — CID 111304913
1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111304913) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111304913 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)Cn1cccn1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C20H32N6O/c1-17(16-26-12-7-9-24-26)14-22-20(21-2)23-15-18(19-8-6-13-27-19)25-10-4-3-5-11-25/h6-9,12-13,17-18H,3-5,10-11,14-16H2,1-2H3,(H2,21,22,23) |
| InChIKey | ULUBDTQUYIWSON-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|