C15H18O7 — CID 11130686
ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-9-oxo-10-propa-1,2-dienyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 11130686) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-9-oxo-10-propa-1,2-dienyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-9-oxo-10-propa-1,2-dienyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 11130686 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl (1R,2R,6R,8S,10R)-4,4-dimethyl-9-oxo-10-propa-1,2-dienyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | C=C=C[C@@]1(C(=O)OCC)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C1=O |
| InChI | InChI=1S/C15H18O7/c1-5-7-15(13(17)18-6-2)11(16)9-8(21-15)10-12(19-9)22-14(3,4)20-10/h7-10,12H,1,6H2,2-4H3/t8-,9-,10+,12+,15+/m0/s1 |
| InChIKey | FQFDFWVWVPRENC-BCLHGEQCSA-N |
| XLogP | 0.47 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|