C22H27FN6 — CID 111307708
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine (PubChem CID 111307708) has the molecular formula C22H27FN6 and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111307708 |
| Molecular Formula | C22H27FN6 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN6/c1-5-24-22(28(4)15-18-6-9-20(23)10-7-18)26-14-19-8-11-21(25-13-19)29-17(3)12-16(2)27-29/h6-13H,5,14-15H2,1-4H3,(H,24,26) |
| InChIKey | XKLPBOJICXJEQG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|