C21H27FIN5 — CID 111307979
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111307979) has the molecular formula C21H27FIN5 and a molecular weight of 495.38 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307979 |
| Molecular Formula | C21H27FIN5 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H26FN5.HI/c1-16-25-19-7-4-5-8-20(19)27(16)14-6-13-24-21(23-2)26(3)15-17-9-11-18(22)12-10-17;/h4-5,7-12H,6,13-15H2,1-3H3,(H,23,24);1H |
| InChIKey | UNWWEBVFOWKSHA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|