C16H24ClN3O2 — CID 111308270
1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111308270) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111308270 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-1,2-dimethyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCCO1)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-18-16(19-12-15-4-3-10-21-15)20(2)9-11-22-14-7-5-13(17)6-8-14/h5-8,15H,3-4,9-12H2,1-2H3,(H,18,19) |
| InChIKey | AOYCJDJAXITBQN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|