C22H36IN5O2 — CID 111309049
N-cyclopropyl-2-[[ethylamino-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111309049) has the molecular formula C22H36IN5O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111309049 |
| Molecular Formula | C22H36IN5O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCC(c1ccc(OC)cc1)N1CCCCC1.I |
| InChI | InChI=1S/C22H35N5O2.HI/c1-3-23-22(25-16-21(28)26-18-9-10-18)24-15-20(27-13-5-4-6-14-27)17-7-11-19(29-2)12-8-17;/h7-8,11-12,18,20H,3-6,9-10,13-16H2,1-2H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | IKXODKIFIVUQOM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|