C13H22SiTe — CID 11131420
[(3E,5E)-6-butyltellanylhexa-3,5-dien-1-ynyl]-trimethylsilane (PubChem CID 11131420) has the molecular formula C13H22SiTe and a molecular weight of 334.00 g/mol. Its IUPAC name is [(3E,5E)-6-butyltellanylhexa-3,5-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5E)-6-butyltellanylhexa-3,5-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11131420 |
| Molecular Formula | C13H22SiTe |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [(3E,5E)-6-butyltellanylhexa-3,5-dien-1-ynyl]-trimethylsilane |
| SMILES | CCCC[Te]/C=C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22SiTe/c1-5-6-12-15-13-10-8-7-9-11-14(2,3)4/h7-8,10,13H,5-6,12H2,1-4H3/b8-7+,13-10+ |
| InChIKey | VMGWKYJOJRZOAM-AWGJLQHSSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|