C21H36FN5O — CID 111314474
1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111314474) has the molecular formula C21H36FN5O and a molecular weight of 393.55 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111314474 |
| Molecular Formula | C21H36FN5O |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NCC(c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C21H36FN5O/c1-6-23-20(25-16-21(2,3)27-11-13-28-14-12-27)24-15-19(26(4)5)17-7-9-18(22)10-8-17/h7-10,19H,6,11-16H2,1-5H3,(H2,23,24,25) |
| InChIKey | JAMXUHIAMWEPDO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|