C22H39N5O3 — CID 111658032
1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111658032) has the molecular formula C22H39N5O3 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111658032 |
| Molecular Formula | C22H39N5O3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCC(c1ccc(OC)cc1)N(C)C |
| InChI | InChI=1S/C22H39N5O3/c1-6-23-21(25-16-22(2,28)17-27-11-13-30-14-12-27)24-15-20(26(3)4)18-7-9-19(29-5)10-8-18/h7-10,20,28H,6,11-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | WPELNDUKQWRIDG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|