About 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane
1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane (PubChem CID 11131587) has the molecular formula C14H21BrF2S
and a molecular weight of 339.29 g/mol. Its IUPAC name is 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane.
Molecular Properties
| Compound Name | 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane |
| PubChem CID | 11131587 |
| Molecular Formula | C14H21BrF2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane |
| SMILES | CSC(F)(F)C(Br)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H21BrF2S/c1-18-14(16,17)12(15)8-13-5-9-2-10(6-13)4-11(3-9)7-13/h9-12H,2-8H2,1H3 |
| InChIKey | SZBXNBKOPOWZKQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane?
The IUPAC name of 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane (CID 11131587) is 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane.
What is the SMILES notation for 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane?
The canonical SMILES for 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane is CSC(F)(F)C(Br)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane?
The InChIKey is SZBXNBKOPOWZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrF2S/c1-18-14(16,17)12(15)8-13-5-9-2-10(6-13)4-11(3-9)7-13/h9-12H,2-8H2,1H3.
What are the key properties of 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane?
1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane has a molecular weight of 339.29 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-3,3-difluoro-3-methylsulfanylpropyl)adamantane is sourced from PubChem (CID 11131587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).