C13H20F2S — CID 11831732
1-(2,2-difluoro-2-methylsulfanylethyl)adamantane (PubChem CID 11831732) has the molecular formula C13H20F2S and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-methylsulfanylethyl)adamantane.
| Compound Name | 1-(2,2-difluoro-2-methylsulfanylethyl)adamantane |
|---|---|
| PubChem CID | 11831732 |
| Molecular Formula | C13H20F2S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-(2,2-difluoro-2-methylsulfanylethyl)adamantane |
| SMILES | CSC(F)(F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H20F2S/c1-16-13(14,15)8-12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-8H2,1H3 |
| InChIKey | XSVOKAGSOXQWBX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |