C15H24F2S — CID 162574614
3-(1-adamantyl)-1,1-difluoropentane-1-thiol (PubChem CID 162574614) has the molecular formula C15H24F2S and a molecular weight of 274.42 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,1-difluoropentane-1-thiol.
| Compound Name | 3-(1-adamantyl)-1,1-difluoropentane-1-thiol |
|---|---|
| PubChem CID | 162574614 |
| Molecular Formula | C15H24F2S |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-(1-adamantyl)-1,1-difluoropentane-1-thiol |
| SMILES | CCC(CC(F)(F)S)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24F2S/c1-2-13(9-15(16,17)18)14-6-10-3-11(7-14)5-12(4-10)8-14/h10-13,18H,2-9H2,1H3 |
| InChIKey | CAHLOZSGWHAABG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|