C12H17F3 — CID 13197348
1-(2,2,2-trifluoroethyl)adamantane (PubChem CID 13197348) has the molecular formula C12H17F3 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)adamantane.
| Compound Name | 1-(2,2,2-trifluoroethyl)adamantane |
|---|---|
| PubChem CID | 13197348 |
| Molecular Formula | C12H17F3 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)adamantane |
| SMILES | FC(F)(F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H17F3/c13-12(14,15)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2 |
| InChIKey | HYBJUADJGKYWEY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |