C17H34F3N5 — CID 111317886
1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111317886) has the molecular formula C17H34F3N5 and a molecular weight of 365.49 g/mol. Its IUPAC name is 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111317886 |
| Molecular Formula | C17H34F3N5 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C17H34F3N5/c1-5-21-16(22-9-6-10-24(4)13-17(18,19)20)23-15-7-11-25(12-8-15)14(2)3/h14-15H,5-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | LWMZWWAYZCOXDW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|