C21H24N2O3 — CID 11131923
methyl (4aS,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,7,8,8a-hexahydroisoquinoline-5-carboxylate (PubChem CID 11131923) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl (4aS,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,7,8,8a-hexahydroisoquinoline-5-carboxylate.
| Compound Name | methyl (4aS,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,7,8,8a-hexahydroisoquinoline-5-carboxylate |
|---|---|
| PubChem CID | 11131923 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | methyl (4aS,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,7,8,8a-hexahydroisoquinoline-5-carboxylate |
| SMILES | COC(=O)C1=CCC[C@@H]2CN(CCc3c[nH]c4ccccc34)C(=O)C[C@H]12 |
| InChI | InChI=1S/C21H24N2O3/c1-26-21(25)17-7-4-5-15-13-23(20(24)11-18(15)17)10-9-14-12-22-19-8-3-2-6-16(14)19/h2-3,6-8,12,15,18,22H,4-5,9-11,13H2,1H3/t15-,18+/m1/s1 |
| InChIKey | GAVCBEVWMLLOIM-QAPCUYQASA-N |
| XLogP | 3.07 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |