C22H28N2O2S2 — CID 11200876
O-ethyl [(4aS,5R,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,5,6,7,8,8a-octahydroisoquinolin-5-yl]sulfanylmethanethioate (PubChem CID 11200876) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is O-ethyl [(4aS,5R,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,5,6,7,8,8a-octahydroisoquinolin-5-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(4aS,5R,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,5,6,7,8,8a-octahydroisoquinolin-5-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11200876 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | O-ethyl [(4aS,5R,8aS)-2-[2-(1H-indol-3-yl)ethyl]-3-oxo-1,4,4a,5,6,7,8,8a-octahydroisoquinolin-5-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@@H]1CCC[C@@H]2CN(CCc3c[nH]c4ccccc34)C(=O)C[C@@H]21 |
| InChI | InChI=1S/C22H28N2O2S2/c1-2-26-22(27)28-20-9-5-6-16-14-24(21(25)12-18(16)20)11-10-15-13-23-19-8-4-3-7-17(15)19/h3-4,7-8,13,16,18,20,23H,2,5-6,9-12,14H2,1H3/t16-,18+,20-/m1/s1 |
| InChIKey | ZNTHCRKCROVUKU-IMFGXOCKSA-N |
| XLogP | 4.78 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|